C24H17F8N7O — CID 118566171
4-amino-5-methyl-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-5-[4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 118566171) has the molecular formula C24H17F8N7O and a molecular weight of 571.43 g/mol. Its IUPAC name is 4-amino-5-methyl-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-5-[4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-methyl-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-5-[4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 118566171 |
| Molecular Formula | C24H17F8N7O |
| Molecular Weight | 571.43 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | 4-amino-5-methyl-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-5-[4-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(c2ccc(C(F)(F)F)cc2)C(=O)Nc2nc(-c3cn4ccnc4c(CCC(F)(F)C(F)(F)F)n3)nc(N)c21 |
| InChI | InChI=1S/C24H17F8N7O/c1-21(11-2-4-12(5-3-11)23(27,28)29)15-16(33)36-17(37-18(15)38-20(21)40)14-10-39-9-8-34-19(39)13(35-14)6-7-22(25,26)24(30,31)32/h2-5,8-10H,6-7H2,1H3,(H3,33,36,37,38,40) |
| InChIKey | CBTRXBAWXGUWSG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|