C26H24N4O2S2 — CID 118568239
1-[4-[[2-(4-methylsulfanylphenyl)phenyl]sulfinylamino]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 118568239) has the molecular formula C26H24N4O2S2 and a molecular weight of 488.64 g/mol. Its IUPAC name is 1-[4-[[2-(4-methylsulfanylphenyl)phenyl]sulfinylamino]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[[2-(4-methylsulfanylphenyl)phenyl]sulfinylamino]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 118568239 |
| Molecular Formula | C26H24N4O2S2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 1-[4-[[2-(4-methylsulfanylphenyl)phenyl]sulfinylamino]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | CSc1ccc(-c2ccccc2S(=O)Nc2ccc(NC(=O)NCc3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C26H24N4O2S2/c1-33-23-14-8-20(9-15-23)24-6-2-3-7-25(24)34(32)30-22-12-10-21(11-13-22)29-26(31)28-18-19-5-4-16-27-17-19/h2-17,30H,18H2,1H3,(H2,28,29,31) |
| InChIKey | WIXXEYUWACXBGL-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |