C26H25N5O2S2 — CID 88907312
1-[4-[[2-[4-[methyl(sulfanyl)amino]phenyl]phenyl]sulfinylamino]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 88907312) has the molecular formula C26H25N5O2S2 and a molecular weight of 503.65 g/mol. Its IUPAC name is 1-[4-[[2-[4-[methyl(sulfanyl)amino]phenyl]phenyl]sulfinylamino]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[[2-[4-[methyl(sulfanyl)amino]phenyl]phenyl]sulfinylamino]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 88907312 |
| Molecular Formula | C26H25N5O2S2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | 1-[4-[[2-[4-[methyl(sulfanyl)amino]phenyl]phenyl]sulfinylamino]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | CN(S)c1ccc(-c2ccccc2S(=O)Nc2ccc(NC(=O)NCc3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C26H25N5O2S2/c1-31(34)23-14-8-20(9-15-23)24-6-2-3-7-25(24)35(33)30-22-12-10-21(11-13-22)29-26(32)28-18-19-5-4-16-27-17-19/h2-17,30,34H,18H2,1H3,(H2,28,29,32) |
| InChIKey | UTZSQMXRVCYWAX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|