C26H30FN7O5S — CID 118568424
tert-butyl N-[(2S,5R)-2-cyclopropyl-5-[5-fluoro-2-[(2-methoxypyrido[3,4-b]pyrazin-5-yl)amino]-4-pyridinyl]-5-methyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-yl]carbamate (PubChem CID 118568424) has the molecular formula C26H30FN7O5S and a molecular weight of 571.64 g/mol. Its IUPAC name is tert-butyl N-[(2S,5R)-2-cyclopropyl-5-[5-fluoro-2-[(2-methoxypyrido[3,4-b]pyrazin-5-yl)amino]-4-pyridinyl]-5-methyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,5R)-2-cyclopropyl-5-[5-fluoro-2-[(2-methoxypyrido[3,4-b]pyrazin-5-yl)amino]-4-pyridinyl]-5-methyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 118568424 |
| Molecular Formula | C26H30FN7O5S |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | tert-butyl N-[(2S,5R)-2-cyclopropyl-5-[5-fluoro-2-[(2-methoxypyrido[3,4-b]pyrazin-5-yl)amino]-4-pyridinyl]-5-methyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-yl]carbamate |
| SMILES | COc1cnc2c(Nc3cc([C@]4(C)CS(=O)(=O)[C@@H](C5CC5)C(NC(=O)OC(C)(C)C)=N4)c(F)cn3)nccc2n1 |
| InChI | InChI=1S/C26H30FN7O5S/c1-25(2,3)39-24(35)33-23-21(14-6-7-14)40(36,37)13-26(4,34-23)15-10-18(29-11-16(15)27)32-22-20-17(8-9-28-22)31-19(38-5)12-30-20/h8-12,14,21H,6-7,13H2,1-5H3,(H,28,29,32)(H,33,34,35)/t21-,26-/m0/s1 |
| InChIKey | QADMDCVXOZPLMB-LVXARBLLSA-N |
| XLogP | 3.66 |
| TPSA | 157.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |