C15H18ClFN2O — CID 11856980
6-chloro-4-cyclopropyl-4-ethyl-3-(2-fluoroethyl)-1H-quinazolin-2-one (PubChem CID 11856980) has the molecular formula C15H18ClFN2O and a molecular weight of 296.77 g/mol. Its IUPAC name is 6-chloro-4-cyclopropyl-4-ethyl-3-(2-fluoroethyl)-1H-quinazolin-2-one.
| Compound Name | 6-chloro-4-cyclopropyl-4-ethyl-3-(2-fluoroethyl)-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 11856980 |
| Molecular Formula | C15H18ClFN2O |
| Molecular Weight | 296.77 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 6-chloro-4-cyclopropyl-4-ethyl-3-(2-fluoroethyl)-1H-quinazolin-2-one |
| SMILES | CCC1(C2CC2)c2cc(Cl)ccc2NC(=O)N1CCF |
| InChI | InChI=1S/C15H18ClFN2O/c1-2-15(10-3-4-10)12-9-11(16)5-6-13(12)18-14(20)19(15)8-7-17/h5-6,9-10H,2-4,7-8H2,1H3,(H,18,20) |
| InChIKey | DPLFOPFBEUVABW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.77 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |