C29H31N3O — CID 118569828
N-(2-aminophenyl)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1H-indole-5-carboxamide (PubChem CID 118569828) has the molecular formula C29H31N3O and a molecular weight of 437.59 g/mol. Its IUPAC name is N-(2-aminophenyl)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1H-indole-5-carboxamide.
| Compound Name | N-(2-aminophenyl)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 118569828 |
| Molecular Formula | C29H31N3O |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | N-(2-aminophenyl)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1H-indole-5-carboxamide |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cc4cc(C(=O)Nc5ccccc5N)ccc4[nH]3)ccc21 |
| InChI | InChI=1S/C29H31N3O/c1-28(2)13-14-29(3,4)22-16-18(9-11-21(22)28)26-17-20-15-19(10-12-24(20)31-26)27(33)32-25-8-6-5-7-23(25)30/h5-12,15-17,31H,13-14,30H2,1-4H3,(H,32,33) |
| InChIKey | NFOBTCXBTRADRA-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|