C27H22N4O3 — CID 11857506
6-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-N-phenylpyridazin-3-amine (PubChem CID 11857506) has the molecular formula C27H22N4O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is 6-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-N-phenylpyridazin-3-amine.
| Compound Name | 6-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-N-phenylpyridazin-3-amine |
|---|---|
| PubChem CID | 11857506 |
| Molecular Formula | C27H22N4O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 6-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-N-phenylpyridazin-3-amine |
| SMILES | COc1cc2nccc(Oc3ccc(-c4ccc(Nc5ccccc5)nn4)cc3)c2cc1OC |
| InChI | InChI=1S/C27H22N4O3/c1-32-25-16-21-23(17-26(25)33-2)28-15-14-24(21)34-20-10-8-18(9-11-20)22-12-13-27(31-30-22)29-19-6-4-3-5-7-19/h3-17H,1-2H3,(H,29,31) |
| InChIKey | FOIXQIWEHZXQNC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |