C25H23ClF3N3O3S — CID 118576964
(2,6-difluorophenyl)methyl N-(3-chloro-4-fluorophenyl)-N'-[2-(3,4-dimethoxy-N-methylanilino)-2-oxoethyl]carbamimidothioate (PubChem CID 118576964) has the molecular formula C25H23ClF3N3O3S and a molecular weight of 537.99 g/mol. Its IUPAC name is (2,6-difluorophenyl)methyl N-(3-chloro-4-fluorophenyl)-N'-[2-(3,4-dimethoxy-N-methylanilino)-2-oxoethyl]carbamimidothioate.
| Compound Name | (2,6-difluorophenyl)methyl N-(3-chloro-4-fluorophenyl)-N'-[2-(3,4-dimethoxy-N-methylanilino)-2-oxoethyl]carbamimidothioate |
|---|---|
| PubChem CID | 118576964 |
| Molecular Formula | C25H23ClF3N3O3S |
| Molecular Weight | 537.99 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | (2,6-difluorophenyl)methyl N-(3-chloro-4-fluorophenyl)-N'-[2-(3,4-dimethoxy-N-methylanilino)-2-oxoethyl]carbamimidothioate |
| SMILES | COc1ccc(N(C)C(=O)C/N=C(/Nc2ccc(F)c(Cl)c2)SCc2c(F)cccc2F)cc1OC |
| InChI | InChI=1S/C25H23ClF3N3O3S/c1-32(16-8-10-22(34-2)23(12-16)35-3)24(33)13-30-25(31-15-7-9-21(29)18(26)11-15)36-14-17-19(27)5-4-6-20(17)28/h4-12H,13-14H2,1-3H3,(H,30,31) |
| InChIKey | GYSLGYBYFYSEGZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.99 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|