C15H18ClN5O3 — CID 118578192
[1-[2-(2-aminoethyl)-5-chloro-4-oxoquinazolin-3-yl]pyrrolidin-3-yl]carbamic acid (PubChem CID 118578192) has the molecular formula C15H18ClN5O3 and a molecular weight of 351.79 g/mol. Its IUPAC name is [1-[2-(2-aminoethyl)-5-chloro-4-oxoquinazolin-3-yl]pyrrolidin-3-yl]carbamic acid.
| Compound Name | [1-[2-(2-aminoethyl)-5-chloro-4-oxoquinazolin-3-yl]pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 118578192 |
| Molecular Formula | C15H18ClN5O3 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [1-[2-(2-aminoethyl)-5-chloro-4-oxoquinazolin-3-yl]pyrrolidin-3-yl]carbamic acid |
| SMILES | NCCc1nc2cccc(Cl)c2c(=O)n1N1CCC(NC(=O)O)C1 |
| InChI | InChI=1S/C15H18ClN5O3/c16-10-2-1-3-11-13(10)14(22)21(12(19-11)4-6-17)20-7-5-9(8-20)18-15(23)24/h1-3,9,18H,4-8,17H2,(H,23,24) |
| InChIKey | JEGKRMRYLHFDRQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |