C14H13ClFN3O4 — CID 175511948
[5-chloro-3-[3-fluoro-3-(hydroxymethyl)cyclobutyl]-4-oxoquinazolin-2-yl]carbamic acid (PubChem CID 175511948) has the molecular formula C14H13ClFN3O4 and a molecular weight of 341.73 g/mol. Its IUPAC name is [5-chloro-3-[3-fluoro-3-(hydroxymethyl)cyclobutyl]-4-oxoquinazolin-2-yl]carbamic acid.
| Compound Name | [5-chloro-3-[3-fluoro-3-(hydroxymethyl)cyclobutyl]-4-oxoquinazolin-2-yl]carbamic acid |
|---|---|
| PubChem CID | 175511948 |
| Molecular Formula | C14H13ClFN3O4 |
| Molecular Weight | 341.73 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | [5-chloro-3-[3-fluoro-3-(hydroxymethyl)cyclobutyl]-4-oxoquinazolin-2-yl]carbamic acid |
| SMILES | O=C(O)Nc1nc2cccc(Cl)c2c(=O)n1C1CC(F)(CO)C1 |
| InChI | InChI=1S/C14H13ClFN3O4/c15-8-2-1-3-9-10(8)11(21)19(12(17-9)18-13(22)23)7-4-14(16,5-7)6-20/h1-3,7,20H,4-6H2,(H,17,18)(H,22,23) |
| InChIKey | LKBNXGFWYIUMHK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.73 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |