C21H20ClN5O3 — CID 118594335
[(3S,4R,5R)-2-(2-amino-6-chloropurin-9-yl)-5-ethyl-3-ethynyl-4-methyloxolan-3-yl] benzoate (PubChem CID 118594335) has the molecular formula C21H20ClN5O3 and a molecular weight of 425.88 g/mol. Its IUPAC name is [(3S,4R,5R)-2-(2-amino-6-chloropurin-9-yl)-5-ethyl-3-ethynyl-4-methyloxolan-3-yl] benzoate.
| Compound Name | [(3S,4R,5R)-2-(2-amino-6-chloropurin-9-yl)-5-ethyl-3-ethynyl-4-methyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 118594335 |
| Molecular Formula | C21H20ClN5O3 |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | [(3S,4R,5R)-2-(2-amino-6-chloropurin-9-yl)-5-ethyl-3-ethynyl-4-methyloxolan-3-yl] benzoate |
| SMILES | C#C[C@]1(OC(=O)c2ccccc2)C(n2cnc3c(Cl)nc(N)nc32)O[C@H](CC)[C@H]1C |
| InChI | InChI=1S/C21H20ClN5O3/c1-4-14-12(3)21(5-2,30-18(28)13-9-7-6-8-10-13)19(29-14)27-11-24-15-16(22)25-20(23)26-17(15)27/h2,6-12,14,19H,4H2,1,3H3,(H2,23,25,26)/t12-,14-,19?,21-/m1/s1 |
| InChIKey | KFBZRHCVBAOFBA-BONUEWESSA-N |
| XLogP | 3.23 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|