C12H20N2O4S2 — CID 118597012
5,7-bis(3-methoxypropyl)-2,3-dithia-5,7-diazabicyclo[2.2.2]octane-6,8-dione (PubChem CID 118597012) has the molecular formula C12H20N2O4S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 5,7-bis(3-methoxypropyl)-2,3-dithia-5,7-diazabicyclo[2.2.2]octane-6,8-dione.
| Compound Name | 5,7-bis(3-methoxypropyl)-2,3-dithia-5,7-diazabicyclo[2.2.2]octane-6,8-dione |
|---|---|
| PubChem CID | 118597012 |
| Molecular Formula | C12H20N2O4S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 5,7-bis(3-methoxypropyl)-2,3-dithia-5,7-diazabicyclo[2.2.2]octane-6,8-dione |
| SMILES | COCCCN1C(=O)C2SSC1C(=O)N2CCCOC |
| InChI | InChI=1S/C12H20N2O4S2/c1-17-7-3-5-13-9(15)12-14(6-4-8-18-2)10(16)11(13)19-20-12/h11-12H,3-8H2,1-2H3 |
| InChIKey | IGIRILRWTSIFOS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|