C9H16F2N2O3 — CID 139925724
4,5-difluoro-1,3-bis(2-methoxyethyl)imidazolidin-2-one (PubChem CID 139925724) has the molecular formula C9H16F2N2O3 and a molecular weight of 238.23 g/mol. Its IUPAC name is 4,5-difluoro-1,3-bis(2-methoxyethyl)imidazolidin-2-one.
| Compound Name | 4,5-difluoro-1,3-bis(2-methoxyethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 139925724 |
| Molecular Formula | C9H16F2N2O3 |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 4,5-difluoro-1,3-bis(2-methoxyethyl)imidazolidin-2-one |
| SMILES | COCCN1C(=O)N(CCOC)C(F)C1F |
| InChI | InChI=1S/C9H16F2N2O3/c1-15-5-3-12-7(10)8(11)13(9(12)14)4-6-16-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | WUUQOLISDDNPCD-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|