C11H21BrN2O3 — CID 139925641
4-bromo-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one (PubChem CID 139925641) has the molecular formula C11H21BrN2O3 and a molecular weight of 309.20 g/mol. Its IUPAC name is 4-bromo-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one.
| Compound Name | 4-bromo-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one |
|---|---|
| PubChem CID | 139925641 |
| Molecular Formula | C11H21BrN2O3 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 4-bromo-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one |
| SMILES | COCCN1C(=O)N(CCOC)C(C)(Br)C1C |
| InChI | InChI=1S/C11H21BrN2O3/c1-9-11(2,12)14(6-8-17-4)10(15)13(9)5-7-16-3/h9H,5-8H2,1-4H3 |
| InChIKey | TUPAEQCIPWXMTG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|