C9H16Br2N2O3 — CID 139925714
4,4-dibromo-1,3-bis(2-methoxyethyl)imidazolidin-2-one (PubChem CID 139925714) has the molecular formula C9H16Br2N2O3 and a molecular weight of 360.05 g/mol. Its IUPAC name is 4,4-dibromo-1,3-bis(2-methoxyethyl)imidazolidin-2-one.
| Compound Name | 4,4-dibromo-1,3-bis(2-methoxyethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 139925714 |
| Molecular Formula | C9H16Br2N2O3 |
| Molecular Weight | 360.05 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | 4,4-dibromo-1,3-bis(2-methoxyethyl)imidazolidin-2-one |
| SMILES | COCCN1CC(Br)(Br)N(CCOC)C1=O |
| InChI | InChI=1S/C9H16Br2N2O3/c1-15-5-3-12-7-9(10,11)13(8(12)14)4-6-16-2/h3-7H2,1-2H3 |
| InChIKey | WKWRFTOUENFUSO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.05 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|