About 4-fluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one
4-fluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one (PubChem CID 139925697) has the molecular formula C11H21FN2O3
and a molecular weight of 248.30 g/mol. Its IUPAC name is 4-fluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one.
Molecular Properties
| Compound Name | 4-fluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one |
| PubChem CID | 139925697 |
| Molecular Formula | C11H21FN2O3 |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 4-fluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one |
| SMILES | COCCN1C(=O)N(CCOC)C(C)(F)C1C |
| InChI | InChI=1S/C11H21FN2O3/c1-9-11(2,12)14(6-8-17-4)10(15)13(9)5-7-16-3/h9H,5-8H2,1-4H3 |
| InChIKey | FYORXNGDJDWCBL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one?
The IUPAC name of 4-fluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one (CID 139925697) is 4-fluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one.
What is the SMILES notation for 4-fluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one?
The canonical SMILES for 4-fluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one is COCCN1C(=O)N(CCOC)C(C)(F)C1C.
What is the InChIKey of 4-fluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one?
The InChIKey is FYORXNGDJDWCBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21FN2O3/c1-9-11(2,12)14(6-8-17-4)10(15)13(9)5-7-16-3/h9H,5-8H2,1-4H3.
What are the key properties of 4-fluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one?
4-fluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one has a molecular weight of 248.30 g/mol, XLogP of 1.09, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1,3-bis(2-methoxyethyl)-4,5-dimethylimidazolidin-2-one is sourced from PubChem (CID 139925697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).