C21H24N4O3 — CID 118597392
1-oxo-N-[(1S,2R)-2-(prop-2-enoylamino)cyclohexyl]-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide (PubChem CID 118597392) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 1-oxo-N-[(1S,2R)-2-(prop-2-enoylamino)cyclohexyl]-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide.
| Compound Name | 1-oxo-N-[(1S,2R)-2-(prop-2-enoylamino)cyclohexyl]-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide |
|---|---|
| PubChem CID | 118597392 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-oxo-N-[(1S,2R)-2-(prop-2-enoylamino)cyclohexyl]-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide |
| SMILES | C=CC(=O)N[C@@H]1CCCC[C@@H]1NC(=O)c1ccc2cc3n(c2c1)CCNC3=O |
| InChI | InChI=1S/C21H24N4O3/c1-2-19(26)23-15-5-3-4-6-16(15)24-20(27)14-8-7-13-11-18-21(28)22-9-10-25(18)17(13)12-14/h2,7-8,11-12,15-16H,1,3-6,9-10H2,(H,22,28)(H,23,26)(H,24,27)/t15-,16+/m1/s1 |
| InChIKey | JWWBYMBMTLRQNM-CVEARBPZSA-N |
| XLogP | 1.73 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|