C25H29N3O3 — CID 118603760
9-oxo-N-[2-(prop-2-enoylamino)cyclohexyl]spiro[7,8-dihydropyrido[1,2-a]indole-6,1'-cyclobutane]-3-carboxamide (PubChem CID 118603760) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 9-oxo-N-[2-(prop-2-enoylamino)cyclohexyl]spiro[7,8-dihydropyrido[1,2-a]indole-6,1'-cyclobutane]-3-carboxamide.
| Compound Name | 9-oxo-N-[2-(prop-2-enoylamino)cyclohexyl]spiro[7,8-dihydropyrido[1,2-a]indole-6,1'-cyclobutane]-3-carboxamide |
|---|---|
| PubChem CID | 118603760 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 9-oxo-N-[2-(prop-2-enoylamino)cyclohexyl]spiro[7,8-dihydropyrido[1,2-a]indole-6,1'-cyclobutane]-3-carboxamide |
| SMILES | C=CC(=O)NC1CCCCC1NC(=O)c1ccc2cc3n(c2c1)C1(CCC1)CCC3=O |
| InChI | InChI=1S/C25H29N3O3/c1-2-23(30)26-18-6-3-4-7-19(18)27-24(31)17-9-8-16-14-21-22(29)10-13-25(11-5-12-25)28(21)20(16)15-17/h2,8-9,14-15,18-19H,1,3-7,10-13H2,(H,26,30)(H,27,31) |
| InChIKey | BIYSWDALOMILHH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|