C20H22N2O3 — CID 118599504
5-[(1S,2S,4S)-2-bicyclo[2.2.2]oct-5-enyl]-5-methyl-3-phenacylimidazolidine-2,4-dione (PubChem CID 118599504) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 5-[(1S,2S,4S)-2-bicyclo[2.2.2]oct-5-enyl]-5-methyl-3-phenacylimidazolidine-2,4-dione.
| Compound Name | 5-[(1S,2S,4S)-2-bicyclo[2.2.2]oct-5-enyl]-5-methyl-3-phenacylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118599504 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 5-[(1S,2S,4S)-2-bicyclo[2.2.2]oct-5-enyl]-5-methyl-3-phenacylimidazolidine-2,4-dione |
| SMILES | CC1([C@H]2C[C@H]3C=C[C@@H]2CC3)NC(=O)N(CC(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C20H22N2O3/c1-20(16-11-13-7-9-14(16)10-8-13)18(24)22(19(25)21-20)12-17(23)15-5-3-2-4-6-15/h2-7,9,13-14,16H,8,10-12H2,1H3,(H,21,25)/t13-,14+,16-,20?/m0/s1 |
| InChIKey | YZTDFUMLSPGHJN-RIGINYJASA-N |
| XLogP | 2.78 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|