C28H31O8P — CID 118599583
[(2R,3R,4S,6S)-6-methyl-5-oxo-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-2-yl]phosphonic acid (PubChem CID 118599583) has the molecular formula C28H31O8P and a molecular weight of 526.52 g/mol. Its IUPAC name is [(2R,3R,4S,6S)-6-methyl-5-oxo-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-2-yl]phosphonic acid.
| Compound Name | [(2R,3R,4S,6S)-6-methyl-5-oxo-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 118599583 |
| Molecular Formula | C28H31O8P |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | [(2R,3R,4S,6S)-6-methyl-5-oxo-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-2-yl]phosphonic acid |
| SMILES | C[C@@H]1O[C@](COCc2ccccc2)(P(=O)(O)O)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1=O |
| InChI | InChI=1S/C28H31O8P/c1-21-25(29)26(34-18-23-13-7-3-8-14-23)27(35-19-24-15-9-4-10-16-24)28(36-21,37(30,31)32)20-33-17-22-11-5-2-6-12-22/h2-16,21,26-27H,17-20H2,1H3,(H2,30,31,32)/t21-,26+,27+,28+/m0/s1 |
| InChIKey | UXDZEAIJQRMYNS-RFNYNIMXSA-N |
| XLogP | 4.24 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|