C19H8BrF7O — CID 118603322
1-[4-[(4-bromophenoxy)-difluoromethyl]-2-fluorophenyl]-2,3,4,5-tetrafluorobenzene (PubChem CID 118603322) has the molecular formula C19H8BrF7O and a molecular weight of 465.16 g/mol. Its IUPAC name is 1-[4-[(4-bromophenoxy)-difluoromethyl]-2-fluorophenyl]-2,3,4,5-tetrafluorobenzene.
| Compound Name | 1-[4-[(4-bromophenoxy)-difluoromethyl]-2-fluorophenyl]-2,3,4,5-tetrafluorobenzene |
|---|---|
| PubChem CID | 118603322 |
| Molecular Formula | C19H8BrF7O |
| Molecular Weight | 465.16 g/mol |
| Exact Mass | 463.96 |
| IUPAC Name | 1-[4-[(4-bromophenoxy)-difluoromethyl]-2-fluorophenyl]-2,3,4,5-tetrafluorobenzene |
| SMILES | Fc1cc(C(F)(F)Oc2ccc(Br)cc2)ccc1-c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H8BrF7O/c20-10-2-4-11(5-3-10)28-19(26,27)9-1-6-12(14(21)7-9)13-8-15(22)17(24)18(25)16(13)23/h1-8H |
| InChIKey | FOCICLCOXAJBEV-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.16 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|