C11H14N2O — CID 118611261
2-(oxiran-2-ylmethyl)-3,4-dihydro-1H-2,6-naphthyridine (PubChem CID 118611261) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethyl)-3,4-dihydro-1H-2,6-naphthyridine.
| Compound Name | 2-(oxiran-2-ylmethyl)-3,4-dihydro-1H-2,6-naphthyridine |
|---|---|
| PubChem CID | 118611261 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-(oxiran-2-ylmethyl)-3,4-dihydro-1H-2,6-naphthyridine |
| SMILES | c1cc2c(cn1)CCN(CC1CO1)C2 |
| InChI | InChI=1S/C11H14N2O/c1-3-12-5-9-2-4-13(6-10(1)9)7-11-8-14-11/h1,3,5,11H,2,4,6-8H2 |
| InChIKey | FDDLBEZVKWOSCJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 28.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|