C12H14FNO — CID 138663432
7-fluoro-2-[[(2R)-oxiran-2-yl]methyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 138663432) has the molecular formula C12H14FNO and a molecular weight of 207.25 g/mol. Its IUPAC name is 7-fluoro-2-[[(2R)-oxiran-2-yl]methyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 7-fluoro-2-[[(2R)-oxiran-2-yl]methyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 138663432 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 7-fluoro-2-[[(2R)-oxiran-2-yl]methyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | Fc1ccc2c(c1)CN(C[C@@H]1CO1)CC2 |
| InChI | InChI=1S/C12H14FNO/c13-11-2-1-9-3-4-14(6-10(9)5-11)7-12-8-15-12/h1-2,5,12H,3-4,6-8H2/t12-/m1/s1 |
| InChIKey | KLMCLNRVDUBWRP-GFCCVEGCSA-N |
| XLogP | 1.58 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|