C16H18ClN3O2S — CID 11861877
4-[6-[[(R)-(4-chlorophenyl)sulfinyl]methyl]-2-methylpyrimidin-4-yl]morpholine (PubChem CID 11861877) has the molecular formula C16H18ClN3O2S and a molecular weight of 351.86 g/mol. Its IUPAC name is 4-[6-[[(R)-(4-chlorophenyl)sulfinyl]methyl]-2-methylpyrimidin-4-yl]morpholine.
| Compound Name | 4-[6-[[(R)-(4-chlorophenyl)sulfinyl]methyl]-2-methylpyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 11861877 |
| Molecular Formula | C16H18ClN3O2S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 4-[6-[[(R)-(4-chlorophenyl)sulfinyl]methyl]-2-methylpyrimidin-4-yl]morpholine |
| SMILES | Cc1nc(C[S@@](=O)c2ccc(Cl)cc2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H18ClN3O2S/c1-12-18-14(10-16(19-12)20-6-8-22-9-7-20)11-23(21)15-4-2-13(17)3-5-15/h2-5,10H,6-9,11H2,1H3/t23-/m1/s1 |
| InChIKey | KZONRLNNGATNLC-HSZRJFAPSA-N |
| XLogP | 2.58 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |