C18H18F3N5O3 — CID 118626193
N-[1-(4-azidobutyl)-2-oxo-4-pyridinyl]-2-[2-(trifluoromethoxy)phenyl]acetamide (PubChem CID 118626193) has the molecular formula C18H18F3N5O3 and a molecular weight of 409.37 g/mol. Its IUPAC name is N-[1-(4-azidobutyl)-2-oxo-4-pyridinyl]-2-[2-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[1-(4-azidobutyl)-2-oxo-4-pyridinyl]-2-[2-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 118626193 |
| Molecular Formula | C18H18F3N5O3 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-[1-(4-azidobutyl)-2-oxo-4-pyridinyl]-2-[2-(trifluoromethoxy)phenyl]acetamide |
| SMILES | [N-]=[N+]=NCCCCn1ccc(NC(=O)Cc2ccccc2OC(F)(F)F)cc1=O |
| InChI | InChI=1S/C18H18F3N5O3/c19-18(20,21)29-15-6-2-1-5-13(15)11-16(27)24-14-7-10-26(17(28)12-14)9-4-3-8-23-25-22/h1-2,5-7,10,12H,3-4,8-9,11H2,(H,24,27) |
| InChIKey | XUTVBSZZCKIBCZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|