C10H10ClNO3 — CID 118627446
2-(7-chloro-3,4-dihydro-2H-1,2-benzoxazin-3-yl)acetic acid (PubChem CID 118627446) has the molecular formula C10H10ClNO3 and a molecular weight of 227.65 g/mol. Its IUPAC name is 2-(7-chloro-3,4-dihydro-2H-1,2-benzoxazin-3-yl)acetic acid.
| Compound Name | 2-(7-chloro-3,4-dihydro-2H-1,2-benzoxazin-3-yl)acetic acid |
|---|---|
| PubChem CID | 118627446 |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 2-(7-chloro-3,4-dihydro-2H-1,2-benzoxazin-3-yl)acetic acid |
| SMILES | O=C(O)CC1Cc2ccc(Cl)cc2ON1 |
| InChI | InChI=1S/C10H10ClNO3/c11-7-2-1-6-3-8(5-10(13)14)12-15-9(6)4-7/h1-2,4,8,12H,3,5H2,(H,13,14) |
| InChIKey | NJRBPZRORWMIGW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |