C5H7N3OS — CID 118628163
3-methyl-5-sulfanylidene-1,2-dihydropyrazole-4-carboxamide (PubChem CID 118628163) has the molecular formula C5H7N3OS and a molecular weight of 157.20 g/mol. Its IUPAC name is 3-methyl-5-sulfanylidene-1,2-dihydropyrazole-4-carboxamide.
| Compound Name | 3-methyl-5-sulfanylidene-1,2-dihydropyrazole-4-carboxamide |
|---|---|
| PubChem CID | 118628163 |
| Molecular Formula | C5H7N3OS |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 3-methyl-5-sulfanylidene-1,2-dihydropyrazole-4-carboxamide |
| SMILES | Cc1[nH][nH]c(=S)c1C(N)=O |
| InChI | InChI=1S/C5H7N3OS/c1-2-3(4(6)9)5(10)8-7-2/h1H3,(H2,6,9)(H2,7,8,10) |
| InChIKey | CNPQWLXCUDZITJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|