C23H22N3O3P — CID 11862870
1,5-dimethyl-4-[[phenoxy(phenyl)phosphoryl]amino]-2-phenylpyrazol-3-one (PubChem CID 11862870) has the molecular formula C23H22N3O3P and a molecular weight of 419.42 g/mol. Its IUPAC name is 1,5-dimethyl-4-[[phenoxy(phenyl)phosphoryl]amino]-2-phenylpyrazol-3-one.
| Compound Name | 1,5-dimethyl-4-[[phenoxy(phenyl)phosphoryl]amino]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 11862870 |
| Molecular Formula | C23H22N3O3P |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 1,5-dimethyl-4-[[phenoxy(phenyl)phosphoryl]amino]-2-phenylpyrazol-3-one |
| SMILES | Cc1c(N[P@@](=O)(Oc2ccccc2)c2ccccc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C23H22N3O3P/c1-18-22(23(27)26(25(18)2)19-12-6-3-7-13-19)24-30(28,21-16-10-5-11-17-21)29-20-14-8-4-9-15-20/h3-17H,1-2H3,(H,24,28)/t30-/m0/s1 |
| InChIKey | YAXIPULOTCLIGF-PMERELPUSA-N |
| XLogP | 4.49 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|