C31H26N3O2P — CID 2326936
4-(dinaphthalen-1-ylphosphorylamino)-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 2326936) has the molecular formula C31H26N3O2P and a molecular weight of 503.54 g/mol. Its IUPAC name is 4-(dinaphthalen-1-ylphosphorylamino)-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-(dinaphthalen-1-ylphosphorylamino)-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 2326936 |
| Molecular Formula | C31H26N3O2P |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 4-(dinaphthalen-1-ylphosphorylamino)-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(NP(=O)(c2cccc3ccccc23)c2cccc3ccccc23)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C31H26N3O2P/c1-22-30(31(35)34(33(22)2)25-16-4-3-5-17-25)32-37(36,28-20-10-14-23-12-6-8-18-26(23)28)29-21-11-15-24-13-7-9-19-27(24)29/h3-21H,1-2H3,(H,32,36) |
| InChIKey | PLIXPOQXHLKBFY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|