C21H26N3O3P — CID 11898095
1,5-dimethyl-4-[[methyl-(4-propan-2-ylphenoxy)phosphoryl]amino]-2-phenylpyrazol-3-one (PubChem CID 11898095) has the molecular formula C21H26N3O3P and a molecular weight of 399.43 g/mol. Its IUPAC name is 1,5-dimethyl-4-[[methyl-(4-propan-2-ylphenoxy)phosphoryl]amino]-2-phenylpyrazol-3-one.
| Compound Name | 1,5-dimethyl-4-[[methyl-(4-propan-2-ylphenoxy)phosphoryl]amino]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 11898095 |
| Molecular Formula | C21H26N3O3P |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 1,5-dimethyl-4-[[methyl-(4-propan-2-ylphenoxy)phosphoryl]amino]-2-phenylpyrazol-3-one |
| SMILES | Cc1c(N[P@@](C)(=O)Oc2ccc(C(C)C)cc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C21H26N3O3P/c1-15(2)17-11-13-19(14-12-17)27-28(5,26)22-20-16(3)23(4)24(21(20)25)18-9-7-6-8-10-18/h6-15H,1-5H3,(H,22,26)/t28-/m0/s1 |
| InChIKey | ZMIXIWMWUHYFII-NDEPHWFRSA-N |
| XLogP | 4.92 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|