C19H22N3O4P — CID 659555
4-[[(2-methoxyphenoxy)-methylphosphoryl]amino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 659555) has the molecular formula C19H22N3O4P and a molecular weight of 387.38 g/mol. Its IUPAC name is 4-[[(2-methoxyphenoxy)-methylphosphoryl]amino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[(2-methoxyphenoxy)-methylphosphoryl]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 659555 |
| Molecular Formula | C19H22N3O4P |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 4-[[(2-methoxyphenoxy)-methylphosphoryl]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | COc1ccccc1OP(C)(=O)Nc1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C19H22N3O4P/c1-14-18(19(23)22(21(14)2)15-10-6-5-7-11-15)20-27(4,24)26-17-13-9-8-12-16(17)25-3/h5-13H,1-4H3,(H,20,24) |
| InChIKey | YCWXMFMYEWLQAY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|