C24H29NOP+ — CID 11862873
[(1R,2R,5S,6R,8S)-5-benzyl-9,9-dimethyl-5-oxo-4-phenyl-5λ5-phosphatricyclo[6.1.1.02,6]dec-3-en-3-yl]azanium (PubChem CID 11862873) has the molecular formula C24H29NOP+ and a molecular weight of 378.48 g/mol. Its IUPAC name is [(1R,2R,5S,6R,8S)-5-benzyl-9,9-dimethyl-5-oxo-4-phenyl-5λ5-phosphatricyclo[6.1.1.02,6]dec-3-en-3-yl]azanium.
| Compound Name | [(1R,2R,5S,6R,8S)-5-benzyl-9,9-dimethyl-5-oxo-4-phenyl-5λ5-phosphatricyclo[6.1.1.02,6]dec-3-en-3-yl]azanium |
|---|---|
| PubChem CID | 11862873 |
| Molecular Formula | C24H29NOP+ |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [(1R,2R,5S,6R,8S)-5-benzyl-9,9-dimethyl-5-oxo-4-phenyl-5λ5-phosphatricyclo[6.1.1.02,6]dec-3-en-3-yl]azanium |
| SMILES | CC1(C)[C@H]2C[C@@H]1[C@@H]1C([NH3+])=C(c3ccccc3)[P@](=O)(Cc3ccccc3)[C@@H]1C2 |
| InChI | InChI=1S/C24H28NOP/c1-24(2)18-13-19(24)21-20(14-18)27(26,15-16-9-5-3-6-10-16)23(22(21)25)17-11-7-4-8-12-17/h3-12,18-21H,13-15,25H2,1-2H3/p+1/t18-,19+,20+,21-,27-/m0/s1 |
| InChIKey | IRGYKPHHAIGJOT-KMCONYDASA-O |
| XLogP | 5.22 |
| TPSA | 44.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|