C20H19N5O — CID 118630202
N-[(3S,4R)-4-azido-1-benzylpyrrolidin-3-yl]-3-phenylprop-2-ynamide (PubChem CID 118630202) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is N-[(3S,4R)-4-azido-1-benzylpyrrolidin-3-yl]-3-phenylprop-2-ynamide.
| Compound Name | N-[(3S,4R)-4-azido-1-benzylpyrrolidin-3-yl]-3-phenylprop-2-ynamide |
|---|---|
| PubChem CID | 118630202 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-[(3S,4R)-4-azido-1-benzylpyrrolidin-3-yl]-3-phenylprop-2-ynamide |
| SMILES | [N-]=[N+]=N[C@@H]1CN(Cc2ccccc2)C[C@@H]1NC(=O)C#Cc1ccccc1 |
| InChI | InChI=1S/C20H19N5O/c21-24-23-19-15-25(13-17-9-5-2-6-10-17)14-18(19)22-20(26)12-11-16-7-3-1-4-8-16/h1-10,18-19H,13-15H2,(H,22,26)/t18-,19+/m0/s1 |
| InChIKey | CYZBAXSYOJZSEF-RBUKOAKNSA-N |
| XLogP | 2.72 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|