C18H20ClN3O — CID 118631248
2-(3-chlorophenyl)-7-methyl-8-pentylimidazo[1,2-a]pyrimidin-5-one (PubChem CID 118631248) has the molecular formula C18H20ClN3O and a molecular weight of 329.83 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-7-methyl-8-pentylimidazo[1,2-a]pyrimidin-5-one.
| Compound Name | 2-(3-chlorophenyl)-7-methyl-8-pentylimidazo[1,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 118631248 |
| Molecular Formula | C18H20ClN3O |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-(3-chlorophenyl)-7-methyl-8-pentylimidazo[1,2-a]pyrimidin-5-one |
| SMILES | CCCCCn1c(C)cc(=O)n2cc(-c3cccc(Cl)c3)nc12 |
| InChI | InChI=1S/C18H20ClN3O/c1-3-4-5-9-21-13(2)10-17(23)22-12-16(20-18(21)22)14-7-6-8-15(19)11-14/h6-8,10-12H,3-5,9H2,1-2H3 |
| InChIKey | GDBZOERLZCMADK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|