C28H32ClN5O2 — CID 118631499
3-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 118631499) has the molecular formula C28H32ClN5O2 and a molecular weight of 506.05 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 3-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 118631499 |
| Molecular Formula | C28H32ClN5O2 |
| Molecular Weight | 506.05 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 3-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | CCCCCn1c(-c2cccc(C(=O)NCCN(C)C)c2)cc(=O)n2cc(-c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C28H32ClN5O2/c1-4-5-6-15-33-25(21-8-7-9-22(17-21)27(36)30-14-16-32(2)3)18-26(35)34-19-24(31-28(33)34)20-10-12-23(29)13-11-20/h7-13,17-19H,4-6,14-16H2,1-3H3,(H,30,36) |
| InChIKey | QBKOIHJKXFEQOH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.05 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|