C28H31ClN4O4 — CID 118631538
4-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]-N-[2-(2-hydroxyethoxy)ethyl]benzamide (PubChem CID 118631538) has the molecular formula C28H31ClN4O4 and a molecular weight of 523.03 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]-N-[2-(2-hydroxyethoxy)ethyl]benzamide.
| Compound Name | 4-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]-N-[2-(2-hydroxyethoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 118631538 |
| Molecular Formula | C28H31ClN4O4 |
| Molecular Weight | 523.03 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 4-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]-N-[2-(2-hydroxyethoxy)ethyl]benzamide |
| SMILES | CCCCCn1c(-c2ccc(C(=O)NCCOCCO)cc2)cc(=O)n2cc(-c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C28H31ClN4O4/c1-2-3-4-14-32-25(21-5-7-22(8-6-21)27(36)30-13-16-37-17-15-34)18-26(35)33-19-24(31-28(32)33)20-9-11-23(29)12-10-20/h5-12,18-19,34H,2-4,13-17H2,1H3,(H,30,36) |
| InChIKey | UJQHSVIBZDIQPH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.03 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|