C30H34ClN5O4S — CID 118631581
4-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]-N-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]benzamide (PubChem CID 118631581) has the molecular formula C30H34ClN5O4S and a molecular weight of 596.15 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]-N-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]benzamide.
| Compound Name | 4-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]-N-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 118631581 |
| Molecular Formula | C30H34ClN5O4S |
| Molecular Weight | 596.15 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | 4-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]-N-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]benzamide |
| SMILES | CCCCCn1c(-c2ccc(C(=O)NCCNC3CCS(=O)(=O)C3)cc2)cc(=O)n2cc(-c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C30H34ClN5O4S/c1-2-3-4-16-35-27(18-28(37)36-19-26(34-30(35)36)21-9-11-24(31)12-10-21)22-5-7-23(8-6-22)29(38)33-15-14-32-25-13-17-41(39,40)20-25/h5-12,18-19,25,32H,2-4,13-17,20H2,1H3,(H,33,38) |
| InChIKey | ZZLKDBDQRUULQW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 114.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.15 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|