C33H33ClN4O4S — CID 118631567
4-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]-N-[2-(4-methylsulfonylphenyl)ethyl]benzamide (PubChem CID 118631567) has the molecular formula C33H33ClN4O4S and a molecular weight of 617.17 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]-N-[2-(4-methylsulfonylphenyl)ethyl]benzamide.
| Compound Name | 4-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]-N-[2-(4-methylsulfonylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 118631567 |
| Molecular Formula | C33H33ClN4O4S |
| Molecular Weight | 617.17 g/mol |
| Exact Mass | 616.19 |
| IUPAC Name | 4-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]-N-[2-(4-methylsulfonylphenyl)ethyl]benzamide |
| SMILES | CCCCCn1c(-c2ccc(C(=O)NCCc3ccc(S(C)(=O)=O)cc3)cc2)cc(=O)n2cc(-c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C33H33ClN4O4S/c1-3-4-5-20-37-30(21-31(39)38-22-29(36-33(37)38)24-12-14-27(34)15-13-24)25-8-10-26(11-9-25)32(40)35-19-18-23-6-16-28(17-7-23)43(2,41)42/h6-17,21-22H,3-5,18-20H2,1-2H3,(H,35,40) |
| InChIKey | IYEXAWTTYGZRIT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.17 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|