C21H24ClN3O3 — CID 144837765
ethyl 2-[7-(4-chlorophenyl)-5-oxo-1-pentylimidazo[1,2-a]pyrimidin-2-yl]acetate (PubChem CID 144837765) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is ethyl 2-[7-(4-chlorophenyl)-5-oxo-1-pentylimidazo[1,2-a]pyrimidin-2-yl]acetate.
| Compound Name | ethyl 2-[7-(4-chlorophenyl)-5-oxo-1-pentylimidazo[1,2-a]pyrimidin-2-yl]acetate |
|---|---|
| PubChem CID | 144837765 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | ethyl 2-[7-(4-chlorophenyl)-5-oxo-1-pentylimidazo[1,2-a]pyrimidin-2-yl]acetate |
| SMILES | CCCCCn1c(CC(=O)OCC)cn2c(=O)cc(-c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C21H24ClN3O3/c1-3-5-6-11-24-17(12-20(27)28-4-2)14-25-19(26)13-18(23-21(24)25)15-7-9-16(22)10-8-15/h7-10,13-14H,3-6,11-12H2,1-2H3 |
| InChIKey | VOGXKCSRRGEPDI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|