C27H34ClN3O4 — CID 144837667
ethyl 2-[4-[7-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-2-yl]cyclohexyl]oxyacetate (PubChem CID 144837667) has the molecular formula C27H34ClN3O4 and a molecular weight of 500.04 g/mol. Its IUPAC name is ethyl 2-[4-[7-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-2-yl]cyclohexyl]oxyacetate.
| Compound Name | ethyl 2-[4-[7-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-2-yl]cyclohexyl]oxyacetate |
|---|---|
| PubChem CID | 144837667 |
| Molecular Formula | C27H34ClN3O4 |
| Molecular Weight | 500.04 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | ethyl 2-[4-[7-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-2-yl]cyclohexyl]oxyacetate |
| SMILES | CCCCCn1c(-c2ccc(Cl)cc2)cc(=O)n2cc(C3CCC(OCC(=O)OCC)CC3)nc12 |
| InChI | InChI=1S/C27H34ClN3O4/c1-3-5-6-15-30-24(20-7-11-21(28)12-8-20)16-25(32)31-17-23(29-27(30)31)19-9-13-22(14-10-19)35-18-26(33)34-4-2/h7-8,11-12,16-17,19,22H,3-6,9-10,13-15,18H2,1-2H3 |
| InChIKey | WVKLHLCNKVCFDZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.04 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|