C22H22F2O3 — CID 118634209
1-[4-(4-ethenoxy-3,5-difluorophenyl)phenyl]-4-ethyl-2,6-dioxabicyclo[2.2.2]octane (PubChem CID 118634209) has the molecular formula C22H22F2O3 and a molecular weight of 372.41 g/mol. Its IUPAC name is 1-[4-(4-ethenoxy-3,5-difluorophenyl)phenyl]-4-ethyl-2,6-dioxabicyclo[2.2.2]octane.
| Compound Name | 1-[4-(4-ethenoxy-3,5-difluorophenyl)phenyl]-4-ethyl-2,6-dioxabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 118634209 |
| Molecular Formula | C22H22F2O3 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-[4-(4-ethenoxy-3,5-difluorophenyl)phenyl]-4-ethyl-2,6-dioxabicyclo[2.2.2]octane |
| SMILES | C=COc1c(F)cc(-c2ccc(C34CCC(CC)(CO3)CO4)cc2)cc1F |
| InChI | InChI=1S/C22H22F2O3/c1-3-21-9-10-22(26-13-21,27-14-21)17-7-5-15(6-8-17)16-11-18(23)20(25-4-2)19(24)12-16/h4-8,11-12H,2-3,9-10,13-14H2,1H3 |
| InChIKey | TVIVLRUVLVDVHR-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|