C19H17N5O4S — CID 118641759
(2S)-2-[[2-[3-(prop-2-enoylamino)phenyl]sulfanyl-5H-pyrrolo[2,3-b]pyrazine-7-carbonyl]amino]propanoic acid (PubChem CID 118641759) has the molecular formula C19H17N5O4S and a molecular weight of 411.44 g/mol. Its IUPAC name is (2S)-2-[[2-[3-(prop-2-enoylamino)phenyl]sulfanyl-5H-pyrrolo[2,3-b]pyrazine-7-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[2-[3-(prop-2-enoylamino)phenyl]sulfanyl-5H-pyrrolo[2,3-b]pyrazine-7-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 118641759 |
| Molecular Formula | C19H17N5O4S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (2S)-2-[[2-[3-(prop-2-enoylamino)phenyl]sulfanyl-5H-pyrrolo[2,3-b]pyrazine-7-carbonyl]amino]propanoic acid |
| SMILES | C=CC(=O)Nc1cccc(Sc2cnc3[nH]cc(C(=O)N[C@@H](C)C(=O)O)c3n2)c1 |
| InChI | InChI=1S/C19H17N5O4S/c1-3-14(25)23-11-5-4-6-12(7-11)29-15-9-21-17-16(24-15)13(8-20-17)18(26)22-10(2)19(27)28/h3-10H,1H2,2H3,(H,20,21)(H,22,26)(H,23,25)(H,27,28)/t10-/m0/s1 |
| InChIKey | MEZYBNUYYOBDCL-JTQLQIEISA-N |
| XLogP | 2.44 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|