C13H13Br2NO — CID 11864269
[(1R,4R,6S,7R)-6,7-dibromo-2-azabicyclo[2.2.1]heptan-2-yl]-phenylmethanone (PubChem CID 11864269) has the molecular formula C13H13Br2NO and a molecular weight of 359.06 g/mol. Its IUPAC name is [(1R,4R,6S,7R)-6,7-dibromo-2-azabicyclo[2.2.1]heptan-2-yl]-phenylmethanone.
| Compound Name | [(1R,4R,6S,7R)-6,7-dibromo-2-azabicyclo[2.2.1]heptan-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 11864269 |
| Molecular Formula | C13H13Br2NO |
| Molecular Weight | 359.06 g/mol |
| Exact Mass | 356.94 |
| IUPAC Name | [(1R,4R,6S,7R)-6,7-dibromo-2-azabicyclo[2.2.1]heptan-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1C[C@H]2C[C@H](Br)[C@@H]1[C@@H]2Br |
| InChI | InChI=1S/C13H13Br2NO/c14-10-6-9-7-16(12(10)11(9)15)13(17)8-4-2-1-3-5-8/h1-5,9-12H,6-7H2/t9-,10+,11-,12-/m1/s1 |
| InChIKey | DKFDXPLRTDNFPL-WRWGMCAJSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.06 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|