C17H25F3O2 — CID 118645284
(2R,3R,4S)-3-butyl-2-[[4-(trifluoromethyl)phenyl]methyl]pentane-1,4-diol (PubChem CID 118645284) has the molecular formula C17H25F3O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is (2R,3R,4S)-3-butyl-2-[[4-(trifluoromethyl)phenyl]methyl]pentane-1,4-diol.
| Compound Name | (2R,3R,4S)-3-butyl-2-[[4-(trifluoromethyl)phenyl]methyl]pentane-1,4-diol |
|---|---|
| PubChem CID | 118645284 |
| Molecular Formula | C17H25F3O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (2R,3R,4S)-3-butyl-2-[[4-(trifluoromethyl)phenyl]methyl]pentane-1,4-diol |
| SMILES | CCCC[C@H]([C@H](CO)Cc1ccc(C(F)(F)F)cc1)[C@H](C)O |
| InChI | InChI=1S/C17H25F3O2/c1-3-4-5-16(12(2)22)14(11-21)10-13-6-8-15(9-7-13)17(18,19)20/h6-9,12,14,16,21-22H,3-5,10-11H2,1-2H3/t12-,14-,16-/m0/s1 |
| InChIKey | FYEHSMGPFZOEAO-NOLJZWGESA-N |
| XLogP | 4.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |