C23H27N4OP — CID 11864773
(3R,4E)-2-phenyl-3-pyrrolidin-1-yl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphole 3-oxide (PubChem CID 11864773) has the molecular formula C23H27N4OP and a molecular weight of 406.47 g/mol. Its IUPAC name is (3R,4E)-2-phenyl-3-pyrrolidin-1-yl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphole 3-oxide.
| Compound Name | (3R,4E)-2-phenyl-3-pyrrolidin-1-yl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphole 3-oxide |
|---|---|
| PubChem CID | 11864773 |
| Molecular Formula | C23H27N4OP |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (3R,4E)-2-phenyl-3-pyrrolidin-1-yl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphole 3-oxide |
| SMILES | CN1/C(=C2\C=NN(c3ccccc3)[P@]2(=O)N2CCCC2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C23H27N4OP/c1-23(2)19-13-7-8-14-20(19)25(3)22(23)21-17-24-27(18-11-5-4-6-12-18)29(21,28)26-15-9-10-16-26/h4-8,11-14,17H,9-10,15-16H2,1-3H3/b22-21+/t29-/m1/s1 |
| InChIKey | ZAICYCXECGCHEE-DUCWWQGGSA-N |
| XLogP | 5.42 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|