C20H23N4OP — CID 2317458
(4Z)-2-methyl-3-oxo-N-phenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3lambda5-diazaphosphol-3-amine (PubChem CID 2317458) has the molecular formula C20H23N4OP and a molecular weight of 366.41 g/mol. Its IUPAC name is (4Z)-2-methyl-3-oxo-N-phenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3lambda5-diazaphosphol-3-amine.
| Compound Name | (4Z)-2-methyl-3-oxo-N-phenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3lambda5-diazaphosphol-3-amine |
|---|---|
| PubChem CID | 2317458 |
| Molecular Formula | C20H23N4OP |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (4Z)-2-methyl-3-oxo-N-phenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3lambda5-diazaphosphol-3-amine |
| SMILES | CN1/C(=C2/C=NN(C)P2(=O)Nc2ccccc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H23N4OP/c1-20(2)16-12-8-9-13-17(16)23(3)19(20)18-14-21-24(4)26(18,25)22-15-10-6-5-7-11-15/h5-14H,1-4H3,(H,22,25)/b19-18- |
| InChIKey | NQEYPKQBJYCSJW-HNENSFHCSA-N |
| XLogP | 4.86 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|