C25H24N3OP — CID 11913566
(3S,4E)-2,3-diphenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphole 3-oxide (PubChem CID 11913566) has the molecular formula C25H24N3OP and a molecular weight of 413.46 g/mol. Its IUPAC name is (3S,4E)-2,3-diphenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphole 3-oxide.
| Compound Name | (3S,4E)-2,3-diphenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphole 3-oxide |
|---|---|
| PubChem CID | 11913566 |
| Molecular Formula | C25H24N3OP |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (3S,4E)-2,3-diphenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphole 3-oxide |
| SMILES | CN1/C(=C2\C=NN(c3ccccc3)[P@]2(=O)c2ccccc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C25H24N3OP/c1-25(2)21-16-10-11-17-22(21)27(3)24(25)23-18-26-28(19-12-6-4-7-13-19)30(23,29)20-14-8-5-9-15-20/h4-18H,1-3H3/b24-23+/t30-/m0/s1 |
| InChIKey | CKTBQSQHOVYXAR-BUZMRHBLSA-N |
| XLogP | 5.74 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|