C25H24N5O3P — CID 5051120
N-(4-nitrophenyl)-3-oxo-2-phenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine (PubChem CID 5051120) has the molecular formula C25H24N5O3P and a molecular weight of 473.47 g/mol. Its IUPAC name is N-(4-nitrophenyl)-3-oxo-2-phenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine.
| Compound Name | N-(4-nitrophenyl)-3-oxo-2-phenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine |
|---|---|
| PubChem CID | 5051120 |
| Molecular Formula | C25H24N5O3P |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | N-(4-nitrophenyl)-3-oxo-2-phenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine |
| SMILES | CN1C(=C2C=NN(c3ccccc3)P2(=O)Nc2ccc([N+](=O)[O-])cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C25H24N5O3P/c1-25(2)21-11-7-8-12-22(21)28(3)24(25)23-17-26-29(19-9-5-4-6-10-19)34(23,33)27-18-13-15-20(16-14-18)30(31)32/h4-17H,1-3H3,(H,27,33) |
| InChIKey | UNKVVKOHVFNAMB-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|