C26H24N5O3P — CID 25361057
(1R)-5,7-dimethyl-6-(4-methylphenyl)-N-(4-nitrophenyl)-1-oxo-2-phenylpyrrolo[3,4-d]diazaphosphinin-1-amine (PubChem CID 25361057) has the molecular formula C26H24N5O3P and a molecular weight of 485.48 g/mol. Its IUPAC name is (1R)-5,7-dimethyl-6-(4-methylphenyl)-N-(4-nitrophenyl)-1-oxo-2-phenylpyrrolo[3,4-d]diazaphosphinin-1-amine.
| Compound Name | (1R)-5,7-dimethyl-6-(4-methylphenyl)-N-(4-nitrophenyl)-1-oxo-2-phenylpyrrolo[3,4-d]diazaphosphinin-1-amine |
|---|---|
| PubChem CID | 25361057 |
| Molecular Formula | C26H24N5O3P |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | (1R)-5,7-dimethyl-6-(4-methylphenyl)-N-(4-nitrophenyl)-1-oxo-2-phenylpyrrolo[3,4-d]diazaphosphinin-1-amine |
| SMILES | Cc1ccc(-n2c(C)c3c(c2C)[P@@](=O)(Nc2ccc([N+](=O)[O-])cc2)N(c2ccccc2)N=C3)cc1 |
| InChI | InChI=1S/C26H24N5O3P/c1-18-9-13-22(14-10-18)29-19(2)25-17-27-30(23-7-5-4-6-8-23)35(34,26(25)20(29)3)28-21-11-15-24(16-12-21)31(32)33/h4-17H,1-3H3,(H,28,34)/t35-/m1/s1 |
| InChIKey | XNRRYRMTRKLAGG-PGUFJCEWSA-N |
| XLogP | 6.10 |
| TPSA | 92.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|