C24H29N6O3P — CID 25357609
4-[(3R,4E)-2-methyl-3-(3-nitrophenyl)imino-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-yl]morpholine (PubChem CID 25357609) has the molecular formula C24H29N6O3P and a molecular weight of 480.51 g/mol. Its IUPAC name is 4-[(3R,4E)-2-methyl-3-(3-nitrophenyl)imino-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-yl]morpholine.
| Compound Name | 4-[(3R,4E)-2-methyl-3-(3-nitrophenyl)imino-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-yl]morpholine |
|---|---|
| PubChem CID | 25357609 |
| Molecular Formula | C24H29N6O3P |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 4-[(3R,4E)-2-methyl-3-(3-nitrophenyl)imino-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-yl]morpholine |
| SMILES | CN1/C(=C2\C=NN(C)[P@]2(=Nc2cccc([N+](=O)[O-])c2)N2CCOCC2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C24H29N6O3P/c1-24(2)20-10-5-6-11-21(20)27(3)23(24)22-17-25-28(4)34(22,29-12-14-33-15-13-29)26-18-8-7-9-19(16-18)30(31)32/h5-11,16-17H,12-15H2,1-4H3/b23-22+/t34-/m0/s1 |
| InChIKey | VPPXDKYTLISBFF-VEJILBAHSA-N |
| XLogP | 5.16 |
| TPSA | 86.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|